Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Chromium(II) chloride, anhydrous, 97%
CAS: 10049-05-5 Molecular Formula: CrCl2 MDL Number: MFCD00010947 Synonym: Chromous chloride
| CAS | 10049-05-5 |
|---|---|
| MDL Number | MFCD00010947 |
| Synonym | Chromous chloride |
| Molecular Formula | CrCl2 |
Titanium carbide, 99.5% (metals basis)
CAS: 12070-08-5 Molecular Formula: CTi Molecular Weight (g/mol): 59.88 MDL Number: MFCD00011268 InChI Key: YXIVWSJCLXKLJL-UHFFFAOYSA-N IUPAC Name: methanidylidynetitaniumylium SMILES: [C-]#[Ti+]
| CAS | 12070-08-5 |
|---|---|
| Molecular Weight (g/mol) | 59.88 |
| MDL Number | MFCD00011268 |
| SMILES | [C-]#[Ti+] |
| IUPAC Name | methanidylidynetitaniumylium |
| InChI Key | YXIVWSJCLXKLJL-UHFFFAOYSA-N |
| Molecular Formula | CTi |
Silicone oil, high temperature, usable temperature range: 25 to 250°C (open system) and 25 to 315°C (closed system)
CAS: 68083-14-7 Molecular Formula: C16H22O2Si2 Molecular Weight (g/mol): 302.52 MDL Number: MFCD00132673 InChI Key: ARWRSWALIGRKQA-UHFFFAOYSA-N Synonym: diphenyl-dimethylsiloxane copolymer,polydimethyl-diphenylsiloxane, viscosity 400cst. PubChem CID: 121233058 IUPAC Name: methoxy-dimethyl-[methyl(diphenyl)silyl]oxysilane SMILES: CO[Si](C)(C)O[Si](C)(C1=CC=CC=C1)C2=CC=CC=C2
| PubChem CID | 121233058 |
|---|---|
| CAS | 68083-14-7 |
| Molecular Weight (g/mol) | 302.52 |
| MDL Number | MFCD00132673 |
| SMILES | CO[Si](C)(C)O[Si](C)(C1=CC=CC=C1)C2=CC=CC=C2 |
| Synonym | diphenyl-dimethylsiloxane copolymer,polydimethyl-diphenylsiloxane, viscosity 400cst. |
| IUPAC Name | methoxy-dimethyl-[methyl(diphenyl)silyl]oxysilane |
| InChI Key | ARWRSWALIGRKQA-UHFFFAOYSA-N |
| Molecular Formula | C16H22O2Si2 |
Sodium bicarbonate, 99.5%, for analysis
CAS: 144-55-8 Molecular Formula: CHNaO3 Molecular Weight (g/mol): 84.01 MDL Number: MFCD00003528 InChI Key: UIIMBOGNXHQVGW-UHFFFAOYSA-M Synonym: sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut PubChem CID: 516892 ChEBI: CHEBI:32139 SMILES: [Na+].OC([O-])=O
| PubChem CID | 516892 |
|---|---|
| CAS | 144-55-8 |
| Molecular Weight (g/mol) | 84.01 |
| ChEBI | CHEBI:32139 |
| MDL Number | MFCD00003528 |
| SMILES | [Na+].OC([O-])=O |
| Synonym | sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut |
| InChI Key | UIIMBOGNXHQVGW-UHFFFAOYSA-M |
| Molecular Formula | CHNaO3 |
Copper(II)-ethylenediamine complex, 1M solution in water
CAS: 14552-35-3 | C4H18CuN4O2 | 217.76 g/mol
| Linear Formula | Cu(H2NCH2CH2NH2)2(OH)2 |
|---|---|
| Molecular Weight (g/mol) | 217.76 |
| Chemical Name or Material | Copper(II)-ethylenediamine complex |
| Density | 1.1000g/mL |
| Name Note | 1M Solution in Water |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| MDL Number | MFCD00274628 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. |
| Packaging | Glass bottle |
| Solubility Information | Solubility in water: soluble |
| Flash Point | >110°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | Bis(ethylenediamine)copper(II)hydroxide |
| TSCA | TSCA |
| Molecular Formula | C4H18CuN4O2 |
| EINECS Number | 238-597-7 |
| Formula Weight | 217.76 |
| Specific Gravity | 1.1 |
Sodium dihydrogen phosphate monohydrate, ACS, 98.0-102.0%
CAS: 10049-21-5 Molecular Formula: H2NaO4P x H2O Molecular Weight (g/mol): 137.99 MDL Number: MFCD00149208 InChI Key: BBMHARZCALWXSL-UHFFFAOYSA-N Synonym: sodium dihydrogen phosphate monohydrate,sodium phosphate monobasic monohydrate,monosodium phosphate monohydrate,unii-593yog76rn,phosphoric acid, monosodium salt, monohydrate,sodium phosphate monobasic hydrate,sodium dihydrogen phosphate hydrate,sodium dihydrogenphosphate monohydrate,sodium hydrate dihydrogen phosphate,pubchem12707 PubChem CID: 516949 SMILES: O.[Na+].OP(O)(O)=O
| PubChem CID | 516949 |
|---|---|
| CAS | 10049-21-5 |
| Molecular Weight (g/mol) | 137.99 |
| MDL Number | MFCD00149208 |
| SMILES | O.[Na+].OP(O)(O)=O |
| Synonym | sodium dihydrogen phosphate monohydrate,sodium phosphate monobasic monohydrate,monosodium phosphate monohydrate,unii-593yog76rn,phosphoric acid, monosodium salt, monohydrate,sodium phosphate monobasic hydrate,sodium dihydrogen phosphate hydrate,sodium dihydrogenphosphate monohydrate,sodium hydrate dihydrogen phosphate,pubchem12707 |
| InChI Key | BBMHARZCALWXSL-UHFFFAOYSA-N |
| Molecular Formula | H2NaO4P x H2O |
Zinc sulfate heptahydrate, 99%, ACS reagent
CAS: 7446-20-0 Molecular Formula: H14O11SZn Molecular Weight (g/mol): 287.54 MDL Number: MFCD00149894 InChI Key: RZLVQBNCHSJZPX-UHFFFAOYSA-L Synonym: zinc sulfate heptahydrate,zinc sulfate jan,zinc sulfate 1:1 heptahydrate,unii-n57ji2k7wp,zinc vitriol heptahydrate,zinc sulfate heptahydrate 1:1:7,white vitriol heptahydrate,ccris 5563,zinc sulfate znso4 heptahydrate,znso4.7h2o PubChem CID: 62640 ChEBI: CHEBI:32312 SMILES: O.O.O.O.O.O.O.[Zn++].[O-]S([O-])(=O)=O
| PubChem CID | 62640 |
|---|---|
| CAS | 7446-20-0 |
| Molecular Weight (g/mol) | 287.54 |
| ChEBI | CHEBI:32312 |
| MDL Number | MFCD00149894 |
| SMILES | O.O.O.O.O.O.O.[Zn++].[O-]S([O-])(=O)=O |
| Synonym | zinc sulfate heptahydrate,zinc sulfate jan,zinc sulfate 1:1 heptahydrate,unii-n57ji2k7wp,zinc vitriol heptahydrate,zinc sulfate heptahydrate 1:1:7,white vitriol heptahydrate,ccris 5563,zinc sulfate znso4 heptahydrate,znso4.7h2o |
| InChI Key | RZLVQBNCHSJZPX-UHFFFAOYSA-L |
| Molecular Formula | H14O11SZn |
Sodium chloride, 99+%, ACS reagent
CAS: 7647-14-5 Molecular Formula: ClNa Molecular Weight (g/mol): 58.44 MDL Number: MFCD00003477 InChI Key: FAPWRFPIFSIZLT-UHFFFAOYSA-M Synonym: sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex PubChem CID: 5234 ChEBI: CHEBI:26710 SMILES: [Na+].[Cl-]
| PubChem CID | 5234 |
|---|---|
| CAS | 7647-14-5 |
| Molecular Weight (g/mol) | 58.44 |
| ChEBI | CHEBI:26710 |
| MDL Number | MFCD00003477 |
| SMILES | [Na+].[Cl-] |
| Synonym | sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex |
| InChI Key | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Molecular Formula | ClNa |
Calcium chloride, anhydrous, ACS, 96.0% min
CAS: 10043-52-4 Molecular Formula: CaCl2 Molecular Weight (g/mol): 110.98 MDL Number: MFCD00010903 InChI Key: UXVMQQNJUSDDNG-UHFFFAOYSA-L Synonym: calcium chloride,calcium dichloride,calcium chloride anhydrous,calcium ii chloride,calciumchloride,caloride,liquical,calcium chloride pellets,isocal,jarcal PubChem CID: 5284359 ChEBI: CHEBI:3312 IUPAC Name: calcium dichloride SMILES: [Cl-].[Cl-].[Ca++]
| PubChem CID | 5284359 |
|---|---|
| CAS | 10043-52-4 |
| Molecular Weight (g/mol) | 110.98 |
| ChEBI | CHEBI:3312 |
| MDL Number | MFCD00010903 |
| SMILES | [Cl-].[Cl-].[Ca++] |
| Synonym | calcium chloride,calcium dichloride,calcium chloride anhydrous,calcium ii chloride,calciumchloride,caloride,liquical,calcium chloride pellets,isocal,jarcal |
| IUPAC Name | calcium dichloride |
| InChI Key | UXVMQQNJUSDDNG-UHFFFAOYSA-L |
| Molecular Formula | CaCl2 |
Sodium Metasilicate, MP Biomedicals
CAS: 13517-24-3 Molecular Formula: H18Na2O12Si Molecular Weight (g/mol): 284.197 InChI Key: PHIQPXBZDGYJOG-UHFFFAOYSA-N Synonym: sodium metasilicate nonahydrate,unii-d8d44215lz,sodium silicate nonahydrate,silicic acid h2sio3 , disodium salt, nonahydrate,disodium oxosilanebis olate nonahydrate,2na.so3i.9h2o,sodium meta-silicate nonahydrate,disodium oxosilanediolate nonahydrate,disodium dioxido oxo silane nonahydrate,sodium oxosilanebis olate-water 1/9 PubChem CID: 61639 IUPAC Name: disodium;dioxido(oxo)silane;nonahydrate SMILES: O.O.O.O.O.O.O.O.O.[O-][Si](=O)[O-].[Na+].[Na+]
| PubChem CID | 61639 |
|---|---|
| CAS | 13517-24-3 |
| Molecular Weight (g/mol) | 284.197 |
| SMILES | O.O.O.O.O.O.O.O.O.[O-][Si](=O)[O-].[Na+].[Na+] |
| Synonym | sodium metasilicate nonahydrate,unii-d8d44215lz,sodium silicate nonahydrate,silicic acid h2sio3 , disodium salt, nonahydrate,disodium oxosilanebis olate nonahydrate,2na.so3i.9h2o,sodium meta-silicate nonahydrate,disodium oxosilanediolate nonahydrate,disodium dioxido oxo silane nonahydrate,sodium oxosilanebis olate-water 1/9 |
| IUPAC Name | disodium;dioxido(oxo)silane;nonahydrate |
| InChI Key | PHIQPXBZDGYJOG-UHFFFAOYSA-N |
| Molecular Formula | H18Na2O12Si |
Lithium hydroxide, anhydrous, 98%
CAS: 1310-65-2 Molecular Formula: HLiO Molecular Weight (g/mol): 23.95 MDL Number: MFCD00011095 InChI Key: WMFOQBRAJBCJND-UHFFFAOYSA-M Synonym: lithium hydroxide,lithium hydrate,lioh,lithium hydroxide anhydrous,lithium hydroxide li oh,lithiumhydroxid,lithiumhydroxide,lithium hydoxide,unii-903yl31jas,lithium hydroxide, anhydrous PubChem CID: 3939 ChEBI: CHEBI:33979 SMILES: [Li+].[OH-]
| PubChem CID | 3939 |
|---|---|
| CAS | 1310-65-2 |
| Molecular Weight (g/mol) | 23.95 |
| ChEBI | CHEBI:33979 |
| MDL Number | MFCD00011095 |
| SMILES | [Li+].[OH-] |
| Synonym | lithium hydroxide,lithium hydrate,lioh,lithium hydroxide anhydrous,lithium hydroxide li oh,lithiumhydroxid,lithiumhydroxide,lithium hydoxide,unii-903yl31jas,lithium hydroxide, anhydrous |
| InChI Key | WMFOQBRAJBCJND-UHFFFAOYSA-M |
| Molecular Formula | HLiO |
| Linear Formula | [CH3(CH2)3]4NF |
|---|---|
| Molecular Weight (g/mol) | 261.47 |
| ChEBI | CHEBI:51990 |
| Color | Brown to Green |
| Physical Form | Solution |
| SMILES | [F-].CCCC[N+](CCCC)(CCCC)CCCC |
| Merck Index | 15,9332 |
| InChI Key | FPGGTKZVZWFYPV-UHFFFAOYSA-M |
| Density | 0.8870g/mL |
| PubChem CID | 2724141 |
| Concentration or Composition (by Analyte or Components) | 0.90 to 1.10M |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| MDL Number | MFCD00011747 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Suspected of causing cancer. May cause respiratory irritation. Highly flammable liquid and vapor. May form explosive peroxides. May cause drowsiness or dizzines |
| Flash Point | −17°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | tetrabutylammonium fluoride,tbaf,tetrabutylazanium fluoride,tetrabutyl ammonium fluoride,tetra-n-butylammonium fluoride,tetrabutylamine, fluoride,n,n,n-tributylbutan-1-aminium fluoride,1-butanaminium, n,n,n-tributyl-, fluoride,n,n,n-tributyl-1-butanaminium fluoride,1-butanaminium, n,n,n-tributyl-, fluoride 1:1 |
| IUPAC Name | tetrabutylazanium;fluoride |
| Molecular Formula | C16H36FN |
| EINECS Number | 207-057-2 |
| Formula Weight | 261.46 |
| Specific Gravity | 0.887 |
Magnesium nitrate hexahydrate, 98+%, ACS reagent
CAS: 13446-18-9 Molecular Formula: H12MgN2O12 Molecular Weight (g/mol): 256.40 MDL Number: MFCD00149779 InChI Key: MFUVDXOKPBAHMC-UHFFFAOYSA-N Synonym: magnesium nitrate hexahydrate,magnesium dinitrate hexahydrate,unii-v85k20ljmk,dusicnan horecnaty czech,v85k20ljmk,nitric acid, magnesium salt, hexahydrate,magnesium ii nitrate 1:2 , hexahydrate,magnesium 2+ ion hexahydrate dinitrate,magnesium, reference standard solution,dusicnan horecnaty PubChem CID: 202877 IUPAC Name: magnesium;dinitrate;hexahydrate SMILES: O.O.O.O.O.O.[Mg++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 202877 |
|---|---|
| CAS | 13446-18-9 |
| Molecular Weight (g/mol) | 256.40 |
| MDL Number | MFCD00149779 |
| SMILES | O.O.O.O.O.O.[Mg++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | magnesium nitrate hexahydrate,magnesium dinitrate hexahydrate,unii-v85k20ljmk,dusicnan horecnaty czech,v85k20ljmk,nitric acid, magnesium salt, hexahydrate,magnesium ii nitrate 1:2 , hexahydrate,magnesium 2+ ion hexahydrate dinitrate,magnesium, reference standard solution,dusicnan horecnaty |
| IUPAC Name | magnesium;dinitrate;hexahydrate |
| InChI Key | MFUVDXOKPBAHMC-UHFFFAOYSA-N |
| Molecular Formula | H12MgN2O12 |
Potassium cyanide, ACS, 96.0% min, Thermo Scientific Chemicals
CAS: 151-50-8 Molecular Formula: CKN Molecular Weight (g/mol): 65.116 MDL Number: MFCD00011397 InChI Key: NNFCIKHAZHQZJG-UHFFFAOYSA-N Synonym: potassium cyanide,potassium cyanide k cn,cyanide of potassium,caswell no. 688a,zyankali,kalium cyanid german,unii-mqd255m2zo,rcra waste number p098,cyanure de potassium french PubChem CID: 9032 IUPAC Name: potassium;cyanide SMILES: [C-]#N.[K+]
| PubChem CID | 9032 |
|---|---|
| CAS | 151-50-8 |
| Molecular Weight (g/mol) | 65.116 |
| MDL Number | MFCD00011397 |
| SMILES | [C-]#N.[K+] |
| Synonym | potassium cyanide,potassium cyanide k cn,cyanide of potassium,caswell no. 688a,zyankali,kalium cyanid german,unii-mqd255m2zo,rcra waste number p098,cyanure de potassium french |
| IUPAC Name | potassium;cyanide |
| InChI Key | NNFCIKHAZHQZJG-UHFFFAOYSA-N |
| Molecular Formula | CKN |
Potassium phosphate, monobasic, 99+%, extra pure
CAS: 7778-77-0 Molecular Formula: H2KO4P Molecular Weight (g/mol): 136.08 MDL Number: MFCD00011401 MFCD00147253 InChI Key: GNSKLFRGEWLPPA-UHFFFAOYSA-M Synonym: potassium dihydrogen phosphate,monopotassium phosphate,potassium phosphate monobasic,potassium phosphate, monobasic,potassium acid phosphate,phosphoric acid, monopotassium salt,monobasic potassium phosphate,monopotassium monophosphate,monopotassium dihydrogen phosphate,monopotassium orthophosphate PubChem CID: 516951 ChEBI: CHEBI:63036 IUPAC Name: potassium dihydrogen phosphate SMILES: [K+].OP(O)([O-])=O
| PubChem CID | 516951 |
|---|---|
| CAS | 7778-77-0 |
| Molecular Weight (g/mol) | 136.08 |
| ChEBI | CHEBI:63036 |
| MDL Number | MFCD00011401 MFCD00147253 |
| SMILES | [K+].OP(O)([O-])=O |
| Synonym | potassium dihydrogen phosphate,monopotassium phosphate,potassium phosphate monobasic,potassium phosphate, monobasic,potassium acid phosphate,phosphoric acid, monopotassium salt,monobasic potassium phosphate,monopotassium monophosphate,monopotassium dihydrogen phosphate,monopotassium orthophosphate |
| IUPAC Name | potassium dihydrogen phosphate |
| InChI Key | GNSKLFRGEWLPPA-UHFFFAOYSA-M |
| Molecular Formula | H2KO4P |